C15H15ClN2O2S — CID 155059859
1-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol (PubChem CID 155059859) has the molecular formula C15H15ClN2O2S and a molecular weight of 322.82 g/mol. Its IUPAC name is 1-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol.
| Compound Name | 1-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol |
|---|---|
| PubChem CID | 155059859 |
| Molecular Formula | C15H15ClN2O2S |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 1-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol |
| SMILES | Cc1c(C(C)O)sc2c(NCc3ccco3)cc(Cl)nc12 |
| InChI | InChI=1S/C15H15ClN2O2S/c1-8-13-15(21-14(8)9(2)19)11(6-12(16)18-13)17-7-10-4-3-5-20-10/h3-6,9,19H,7H2,1-2H3,(H,17,18) |
| InChIKey | ZAYHZXZUQPYAHU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|