C17H17ClN4OS — CID 164755990
2-[(2R)-2-amino-3-isocyanopropyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine (PubChem CID 164755990) has the molecular formula C17H17ClN4OS and a molecular weight of 360.87 g/mol. Its IUPAC name is 2-[(2R)-2-amino-3-isocyanopropyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(2R)-2-amino-3-isocyanopropyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 164755990 |
| Molecular Formula | C17H17ClN4OS |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-[(2R)-2-amino-3-isocyanopropyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine |
| SMILES | [C-]#[N+]C[C@H](N)Cc1sc2c(NCc3ccco3)cc(Cl)nc2c1C |
| InChI | InChI=1S/C17H17ClN4OS/c1-10-14(6-11(19)8-20-2)24-17-13(7-15(18)22-16(10)17)21-9-12-4-3-5-23-12/h3-5,7,11H,6,8-9,19H2,1H3,(H,21,22)/t11-/m1/s1 |
| InChIKey | YUHYKRKASNTLPJ-LLVKDONJSA-N |
| XLogP | 4.25 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|