C16H20Cl3N3O2S — CID 175189837
2-(2-aminopropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methoxythieno[3,2-b]pyridin-7-amine;dihydrochloride (PubChem CID 175189837) has the molecular formula C16H20Cl3N3O2S and a molecular weight of 424.78 g/mol. Its IUPAC name is 2-(2-aminopropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methoxythieno[3,2-b]pyridin-7-amine;dihydrochloride.
| Compound Name | 2-(2-aminopropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methoxythieno[3,2-b]pyridin-7-amine;dihydrochloride |
|---|---|
| PubChem CID | 175189837 |
| Molecular Formula | C16H20Cl3N3O2S |
| Molecular Weight | 424.78 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 2-(2-aminopropyl)-5-chloro-N-(furan-2-ylmethyl)-3-methoxythieno[3,2-b]pyridin-7-amine;dihydrochloride |
| SMILES | COc1c(CC(C)N)sc2c(NCc3ccco3)cc(Cl)nc12.Cl.Cl |
| InChI | InChI=1S/C16H18ClN3O2S.2ClH/c1-9(18)6-12-15(21-2)14-16(23-12)11(7-13(17)20-14)19-8-10-4-3-5-22-10;;/h3-5,7,9H,6,8,18H2,1-2H3,(H,19,20);2*1H |
| InChIKey | MPBXGJMEGPEORM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.78 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|