C16H14BrClN4OS — CID 155059858
3-amino-4-[3-bromo-5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]butanenitrile (PubChem CID 155059858) has the molecular formula C16H14BrClN4OS and a molecular weight of 425.74 g/mol. Its IUPAC name is 3-amino-4-[3-bromo-5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]butanenitrile.
| Compound Name | 3-amino-4-[3-bromo-5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]butanenitrile |
|---|---|
| PubChem CID | 155059858 |
| Molecular Formula | C16H14BrClN4OS |
| Molecular Weight | 425.74 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | 3-amino-4-[3-bromo-5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]butanenitrile |
| SMILES | N#CCC(N)Cc1sc2c(NCc3ccco3)cc(Cl)nc2c1Br |
| InChI | InChI=1S/C16H14BrClN4OS/c17-14-12(6-9(20)3-4-19)24-16-11(7-13(18)22-15(14)16)21-8-10-2-1-5-23-10/h1-2,5,7,9H,3,6,8,20H2,(H,21,22) |
| InChIKey | YVJKFRLWBNTWLR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.74 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|