C13H8ClN3OS — CID 154681219
5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridine-3-carbonitrile (PubChem CID 154681219) has the molecular formula C13H8ClN3OS and a molecular weight of 289.75 g/mol. Its IUPAC name is 5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridine-3-carbonitrile.
| Compound Name | 5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 154681219 |
| Molecular Formula | C13H8ClN3OS |
| Molecular Weight | 289.75 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridine-3-carbonitrile |
| SMILES | N#Cc1csc2c(NCc3ccco3)cc(Cl)nc12 |
| InChI | InChI=1S/C13H8ClN3OS/c14-11-4-10(16-6-9-2-1-3-18-9)13-12(17-11)8(5-15)7-19-13/h1-4,7H,6H2,(H,16,17) |
| InChIKey | VGCWISIHLRFBOJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.75 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|