C20H27Cl2N3OS — CID 170644231
cyclohexanamine;3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;ethane (PubChem CID 170644231) has the molecular formula C20H27Cl2N3OS and a molecular weight of 428.43 g/mol. Its IUPAC name is cyclohexanamine;3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;ethane.
| Compound Name | cyclohexanamine;3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;ethane |
|---|---|
| PubChem CID | 170644231 |
| Molecular Formula | C20H27Cl2N3OS |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | cyclohexanamine;3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;ethane |
| SMILES | CC.Clc1cc(NCc2ccco2)c2scc(Cl)c2n1.NC1CCCCC1 |
| InChI | InChI=1S/C12H8Cl2N2OS.C6H13N.C2H6/c13-8-6-18-12-9(4-10(14)16-11(8)12)15-5-7-2-1-3-17-7;7-6-4-2-1-3-5-6;1-2/h1-4,6H,5H2,(H,15,16);6H,1-5,7H2;1-2H3 |
| InChIKey | NUAGRCQYZMVIAL-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|