C21H29BrClN3S2 — CID 170644260
3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;ethane;3-methylcyclohexan-1-amine (PubChem CID 170644260) has the molecular formula C21H29BrClN3S2 and a molecular weight of 502.98 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;ethane;3-methylcyclohexan-1-amine.
| Compound Name | 3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;ethane;3-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 170644260 |
| Molecular Formula | C21H29BrClN3S2 |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | 3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;ethane;3-methylcyclohexan-1-amine |
| SMILES | CC.CC1CCCC(N)C1.Clc1cc(NCc2cccs2)c2scc(Br)c2n1 |
| InChI | InChI=1S/C12H8BrClN2S2.C7H15N.C2H6/c13-8-6-18-12-9(4-10(14)16-11(8)12)15-5-7-2-1-3-17-7;1-6-3-2-4-7(8)5-6;1-2/h1-4,6H,5H2,(H,15,16);6-7H,2-5,8H2,1H3;1-2H3 |
| InChIKey | XHJKOCAMZJOEIX-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|