C17H17Cl2N3S2 — CID 170644885
2-[(1R,2R)-2-aminocyclopentyl]-3,5-dichloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170644885) has the molecular formula C17H17Cl2N3S2 and a molecular weight of 398.38 g/mol. Its IUPAC name is 2-[(1R,2R)-2-aminocyclopentyl]-3,5-dichloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(1R,2R)-2-aminocyclopentyl]-3,5-dichloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644885 |
| Molecular Formula | C17H17Cl2N3S2 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 2-[(1R,2R)-2-aminocyclopentyl]-3,5-dichloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | N[C@@H]1CCC[C@H]1c1sc2c(NCc3cccs3)cc(Cl)nc2c1Cl |
| InChI | InChI=1S/C17H17Cl2N3S2/c18-13-7-12(21-8-9-3-2-6-23-9)17-15(22-13)14(19)16(24-17)10-4-1-5-11(10)20/h2-3,6-7,10-11H,1,4-5,8,20H2,(H,21,22)/t10-,11-/m1/s1 |
| InChIKey | WSEDLLFVGRJYIB-GHMZBOCLSA-N |
| XLogP | 5.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|