C17H18BrClN4S2 — CID 170644022
2-[(2R,3R)-3-aminopiperidin-2-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170644022) has the molecular formula C17H18BrClN4S2 and a molecular weight of 457.85 g/mol. Its IUPAC name is 2-[(2R,3R)-3-aminopiperidin-2-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(2R,3R)-3-aminopiperidin-2-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644022 |
| Molecular Formula | C17H18BrClN4S2 |
| Molecular Weight | 457.85 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | 2-[(2R,3R)-3-aminopiperidin-2-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | N[C@@H]1CCCN[C@H]1c1sc2c(NCc3cccs3)cc(Cl)nc2c1Br |
| InChI | InChI=1S/C17H18BrClN4S2/c18-13-15-16(25-17(13)14-10(20)4-1-5-21-14)11(7-12(19)23-15)22-8-9-3-2-6-24-9/h2-3,6-7,10,14,21H,1,4-5,8,20H2,(H,22,23)/t10-,14-/m1/s1 |
| InChIKey | WLKFONQIJGLGBJ-QMTHXVAHSA-N |
| XLogP | 5.14 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.85 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|