C20H18BrClF5N3O2S2 — CID 175971983
2-[(1R,6R)-6-amino-2,2-difluorocyclohexyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid (PubChem CID 175971983) has the molecular formula C20H18BrClF5N3O2S2 and a molecular weight of 606.86 g/mol. Its IUPAC name is 2-[(1R,6R)-6-amino-2,2-difluorocyclohexyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(1R,6R)-6-amino-2,2-difluorocyclohexyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175971983 |
| Molecular Formula | C20H18BrClF5N3O2S2 |
| Molecular Weight | 606.86 g/mol |
| Exact Mass | 604.96 |
| IUPAC Name | 2-[(1R,6R)-6-amino-2,2-difluorocyclohexyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid |
| SMILES | N[C@@H]1CCCC(F)(F)[C@@H]1c1sc2c(NCc3cccs3)cc(Cl)nc2c1Br.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H17BrClF2N3S2.C2HF3O2/c19-14-15-16(27-17(14)13-10(23)4-1-5-18(13,21)22)11(7-12(20)25-15)24-8-9-3-2-6-26-9;3-2(4,5)1(6)7/h2-3,6-7,10,13H,1,4-5,8,23H2,(H,24,25);(H,6,7)/t10-,13+;/m1./s1 |
| InChIKey | XERSGVRPDZQSNL-HTKOBJQYSA-N |
| XLogP | 7.25 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.86 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|