C21H25BrClN3O2S2 — CID 175971932
2-[(1R,2R)-2-amino-5,5-dimethylcyclohexyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;formic acid (PubChem CID 175971932) has the molecular formula C21H25BrClN3O2S2 and a molecular weight of 530.94 g/mol. Its IUPAC name is 2-[(1R,2R)-2-amino-5,5-dimethylcyclohexyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;formic acid.
| Compound Name | 2-[(1R,2R)-2-amino-5,5-dimethylcyclohexyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;formic acid |
|---|---|
| PubChem CID | 175971932 |
| Molecular Formula | C21H25BrClN3O2S2 |
| Molecular Weight | 530.94 g/mol |
| Exact Mass | 529.03 |
| IUPAC Name | 2-[(1R,2R)-2-amino-5,5-dimethylcyclohexyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;formic acid |
| SMILES | CC1(C)CC[C@@H](N)[C@H](c2sc3c(NCc4cccs4)cc(Cl)nc3c2Br)C1.O=CO |
| InChI | InChI=1S/C20H23BrClN3S2.CH2O2/c1-20(2)6-5-13(23)12(9-20)18-16(21)17-19(27-18)14(8-15(22)25-17)24-10-11-4-3-7-26-11;2-1-3/h3-4,7-8,12-13H,5-6,9-10,23H2,1-2H3,(H,24,25);1H,(H,2,3)/t12-,13-;/m1./s1 |
| InChIKey | MDRZJXAXQTZITL-OJERSXHUSA-N |
| XLogP | 6.71 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.94 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|