C19H21BrClN3S2 — CID 170644658
2-(2-aminocycloheptyl)-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170644658) has the molecular formula C19H21BrClN3S2 and a molecular weight of 470.89 g/mol. Its IUPAC name is 2-(2-aminocycloheptyl)-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-(2-aminocycloheptyl)-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644658 |
| Molecular Formula | C19H21BrClN3S2 |
| Molecular Weight | 470.89 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | 2-(2-aminocycloheptyl)-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | NC1CCCCCC1c1sc2c(NCc3cccs3)cc(Cl)nc2c1Br |
| InChI | InChI=1S/C19H21BrClN3S2/c20-16-17-19(26-18(16)12-6-2-1-3-7-13(12)22)14(9-15(21)24-17)23-10-11-5-4-8-25-11/h4-5,8-9,12-13H,1-3,6-7,10,22H2,(H,23,24) |
| InChIKey | SLKDECHMRKNZTD-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.89 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|