C24H24ClN3S2 — CID 170644789
2-[(1S,2S)-2-aminocyclohexyl]-5-chloro-3-phenyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170644789) has the molecular formula C24H24ClN3S2 and a molecular weight of 454.06 g/mol. Its IUPAC name is 2-[(1S,2S)-2-aminocyclohexyl]-5-chloro-3-phenyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(1S,2S)-2-aminocyclohexyl]-5-chloro-3-phenyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644789 |
| Molecular Formula | C24H24ClN3S2 |
| Molecular Weight | 454.06 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-[(1S,2S)-2-aminocyclohexyl]-5-chloro-3-phenyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | N[C@H]1CCCC[C@@H]1c1sc2c(NCc3cccs3)cc(Cl)nc2c1-c1ccccc1 |
| InChI | InChI=1S/C24H24ClN3S2/c25-20-13-19(27-14-16-9-6-12-29-16)24-22(28-20)21(15-7-2-1-3-8-15)23(30-24)17-10-4-5-11-18(17)26/h1-3,6-9,12-13,17-18H,4-5,10-11,14,26H2,(H,27,28)/t17-,18-/m0/s1 |
| InChIKey | PWYIIRSVTGUAIV-ROUUACIJSA-N |
| XLogP | 7.28 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.06 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|