C17H17BrClN3OS2 — CID 170644709
2-[(3R,4R)-3-aminooxan-4-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170644709) has the molecular formula C17H17BrClN3OS2 and a molecular weight of 458.83 g/mol. Its IUPAC name is 2-[(3R,4R)-3-aminooxan-4-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(3R,4R)-3-aminooxan-4-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644709 |
| Molecular Formula | C17H17BrClN3OS2 |
| Molecular Weight | 458.83 g/mol |
| Exact Mass | 456.97 |
| IUPAC Name | 2-[(3R,4R)-3-aminooxan-4-yl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | N[C@H]1COCC[C@H]1c1sc2c(NCc3cccs3)cc(Cl)nc2c1Br |
| InChI | InChI=1S/C17H17BrClN3OS2/c18-14-15-17(25-16(14)10-3-4-23-8-11(10)20)12(6-13(19)22-15)21-7-9-2-1-5-24-9/h1-2,5-6,10-11H,3-4,7-8,20H2,(H,21,22)/t10-,11+/m1/s1 |
| InChIKey | ABSSFOCQSDEQIC-MNOVXSKESA-N |
| XLogP | 5.22 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.83 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|