C17H18BrClN4O3S2 — CID 175971944
6-[(3R,4S)-3-aminooxan-4-yl]-7-bromo-2-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine;formic acid (PubChem CID 175971944) has the molecular formula C17H18BrClN4O3S2 and a molecular weight of 505.85 g/mol. Its IUPAC name is 6-[(3R,4S)-3-aminooxan-4-yl]-7-bromo-2-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine;formic acid.
| Compound Name | 6-[(3R,4S)-3-aminooxan-4-yl]-7-bromo-2-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine;formic acid |
|---|---|
| PubChem CID | 175971944 |
| Molecular Formula | C17H18BrClN4O3S2 |
| Molecular Weight | 505.85 g/mol |
| Exact Mass | 503.97 |
| IUPAC Name | 6-[(3R,4S)-3-aminooxan-4-yl]-7-bromo-2-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-d]pyrimidin-4-amine;formic acid |
| SMILES | N[C@H]1COCC[C@@H]1c1sc2c(NCc3cccs3)nc(Cl)nc2c1Br.O=CO |
| InChI | InChI=1S/C16H16BrClN4OS2.CH2O2/c17-11-12-14(25-13(11)9-3-4-23-7-10(9)19)15(22-16(18)21-12)20-6-8-2-1-5-24-8;2-1-3/h1-2,5,9-10H,3-4,6-7,19H2,(H,20,21,22);1H,(H,2,3)/t9-,10-;/m0./s1 |
| InChIKey | SQESWWGRNOVDME-IYPAPVHQSA-N |
| XLogP | 4.31 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.85 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|