C23H26ClF3N4O4SSi — CID 175971966
6-[(3R,4S)-3-aminooxan-4-yl]-2-chloro-N-(furan-2-ylmethyl)-7-(2-trimethylsilylethynyl)thieno[3,2-d]pyrimidin-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 175971966) has the molecular formula C23H26ClF3N4O4SSi and a molecular weight of 575.09 g/mol. Its IUPAC name is 6-[(3R,4S)-3-aminooxan-4-yl]-2-chloro-N-(furan-2-ylmethyl)-7-(2-trimethylsilylethynyl)thieno[3,2-d]pyrimidin-4-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[(3R,4S)-3-aminooxan-4-yl]-2-chloro-N-(furan-2-ylmethyl)-7-(2-trimethylsilylethynyl)thieno[3,2-d]pyrimidin-4-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175971966 |
| Molecular Formula | C23H26ClF3N4O4SSi |
| Molecular Weight | 575.09 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | 6-[(3R,4S)-3-aminooxan-4-yl]-2-chloro-N-(furan-2-ylmethyl)-7-(2-trimethylsilylethynyl)thieno[3,2-d]pyrimidin-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | C[Si](C)(C)C#Cc1c([C@H]2CCOC[C@@H]2N)sc2c(NCc3ccco3)nc(Cl)nc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H25ClN4O2SSi.C2HF3O2/c1-30(2,3)10-7-15-17-19(29-18(15)14-6-9-27-12-16(14)23)20(26-21(22)25-17)24-11-13-5-4-8-28-13;3-2(4,5)1(6)7/h4-5,8,14,16H,6,9,11-12,23H2,1-3H3,(H,24,25,26);(H,6,7)/t14-,16-;/m0./s1 |
| InChIKey | OTDPAKOLJLQKET-DMLYUBSXSA-N |
| XLogP | 5.24 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.09 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|