C16H16ClIN4O2S — CID 170644551
6-[(2R,3R)-3-aminooxan-2-yl]-2-chloro-N-(furan-2-ylmethyl)-7-iodothieno[3,2-d]pyrimidin-4-amine (PubChem CID 170644551) has the molecular formula C16H16ClIN4O2S and a molecular weight of 490.75 g/mol. Its IUPAC name is 6-[(2R,3R)-3-aminooxan-2-yl]-2-chloro-N-(furan-2-ylmethyl)-7-iodothieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-[(2R,3R)-3-aminooxan-2-yl]-2-chloro-N-(furan-2-ylmethyl)-7-iodothieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170644551 |
| Molecular Formula | C16H16ClIN4O2S |
| Molecular Weight | 490.75 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | 6-[(2R,3R)-3-aminooxan-2-yl]-2-chloro-N-(furan-2-ylmethyl)-7-iodothieno[3,2-d]pyrimidin-4-amine |
| SMILES | N[C@@H]1CCCO[C@H]1c1sc2c(NCc3ccco3)nc(Cl)nc2c1I |
| InChI | InChI=1S/C16H16ClIN4O2S/c17-16-21-11-10(18)13(12-9(19)4-2-6-24-12)25-14(11)15(22-16)20-7-8-3-1-5-23-8/h1,3,5,9,12H,2,4,6-7,19H2,(H,20,21,22)/t9-,12-/m1/s1 |
| InChIKey | BJULGKIDHJTQMQ-BXKDBHETSA-N |
| XLogP | 4.33 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.75 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|