C15H16ClN5O3 — CID 134480891
2-chloro-N-(furan-2-ylmethyl)-8-[[(2S)-oxolan-2-yl]methoxy]-7H-purin-6-amine (PubChem CID 134480891) has the molecular formula C15H16ClN5O3 and a molecular weight of 349.78 g/mol. Its IUPAC name is 2-chloro-N-(furan-2-ylmethyl)-8-[[(2S)-oxolan-2-yl]methoxy]-7H-purin-6-amine.
| Compound Name | 2-chloro-N-(furan-2-ylmethyl)-8-[[(2S)-oxolan-2-yl]methoxy]-7H-purin-6-amine |
|---|---|
| PubChem CID | 134480891 |
| Molecular Formula | C15H16ClN5O3 |
| Molecular Weight | 349.78 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-chloro-N-(furan-2-ylmethyl)-8-[[(2S)-oxolan-2-yl]methoxy]-7H-purin-6-amine |
| SMILES | Clc1nc(NCc2ccco2)c2[nH]c(OC[C@@H]3CCCO3)nc2n1 |
| InChI | InChI=1S/C15H16ClN5O3/c16-14-19-12(17-7-9-3-1-5-22-9)11-13(20-14)21-15(18-11)24-8-10-4-2-6-23-10/h1,3,5,10H,2,4,6-8H2,(H2,17,18,19,20,21)/t10-/m0/s1 |
| InChIKey | NJIQOVXUMMZJJZ-JTQLQIEISA-N |
| XLogP | 2.77 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.78 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |