C17H14ClN5O2 — CID 134480957
2-chloro-N-(furan-2-ylmethyl)-8-phenylmethoxy-7H-purin-6-amine (PubChem CID 134480957) has the molecular formula C17H14ClN5O2 and a molecular weight of 355.79 g/mol. Its IUPAC name is 2-chloro-N-(furan-2-ylmethyl)-8-phenylmethoxy-7H-purin-6-amine.
| Compound Name | 2-chloro-N-(furan-2-ylmethyl)-8-phenylmethoxy-7H-purin-6-amine |
|---|---|
| PubChem CID | 134480957 |
| Molecular Formula | C17H14ClN5O2 |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-chloro-N-(furan-2-ylmethyl)-8-phenylmethoxy-7H-purin-6-amine |
| SMILES | Clc1nc(NCc2ccco2)c2[nH]c(OCc3ccccc3)nc2n1 |
| InChI | InChI=1S/C17H14ClN5O2/c18-16-21-14(19-9-12-7-4-8-24-12)13-15(22-16)23-17(20-13)25-10-11-5-2-1-3-6-11/h1-8H,9-10H2,(H2,19,20,21,22,23) |
| InChIKey | PZVPRGGAMMSLTA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |