C19H23ClFN5O — CID 170644513
2-chloro-5-[(cyclohexylamino)-fluoromethyl]-N-(furan-2-ylmethyl)-7-methylpyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 170644513) has the molecular formula C19H23ClFN5O and a molecular weight of 391.88 g/mol. Its IUPAC name is 2-chloro-5-[(cyclohexylamino)-fluoromethyl]-N-(furan-2-ylmethyl)-7-methylpyrrolo[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-5-[(cyclohexylamino)-fluoromethyl]-N-(furan-2-ylmethyl)-7-methylpyrrolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170644513 |
| Molecular Formula | C19H23ClFN5O |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-chloro-5-[(cyclohexylamino)-fluoromethyl]-N-(furan-2-ylmethyl)-7-methylpyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1cn(C(F)NC2CCCCC2)c2c(NCc3ccco3)nc(Cl)nc12 |
| InChI | InChI=1S/C19H23ClFN5O/c1-12-11-26(19(21)23-13-6-3-2-4-7-13)16-15(12)24-18(20)25-17(16)22-10-14-8-5-9-27-14/h5,8-9,11,13,19,23H,2-4,6-7,10H2,1H3,(H,22,24,25) |
| InChIKey | URTUSVKQMUCNOK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 67.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|