C18H19ClN4OS — CID 170644582
6-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-2-chloro-N-(furan-2-ylmethyl)-7-methylthieno[3,2-d]pyrimidin-4-amine (PubChem CID 170644582) has the molecular formula C18H19ClN4OS and a molecular weight of 374.90 g/mol. Its IUPAC name is 6-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-2-chloro-N-(furan-2-ylmethyl)-7-methylthieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-2-chloro-N-(furan-2-ylmethyl)-7-methylthieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170644582 |
| Molecular Formula | C18H19ClN4OS |
| Molecular Weight | 374.90 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 6-[(1S,6S)-6-aminocyclohex-3-en-1-yl]-2-chloro-N-(furan-2-ylmethyl)-7-methylthieno[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1c([C@H]2CC=CC[C@@H]2N)sc2c(NCc3ccco3)nc(Cl)nc12 |
| InChI | InChI=1S/C18H19ClN4OS/c1-10-14-16(25-15(10)12-6-2-3-7-13(12)20)17(23-18(19)22-14)21-9-11-5-4-8-24-11/h2-5,8,12-13H,6-7,9,20H2,1H3,(H,21,22,23)/t12-,13-/m0/s1 |
| InChIKey | UBWRAEVVANSADF-STQMWFEESA-N |
| XLogP | 4.62 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|