C21H23B6ClN4OS — CID 170644900
CID 170644900 (PubChem CID 170644900) has the molecular formula C21H23B6ClN4OS and a molecular weight of 479.83 g/mol.
| Compound Name | CID 170644900 |
|---|---|
| PubChem CID | 170644900 |
| Molecular Formula | C21H23B6ClN4OS |
| Molecular Weight | 479.83 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | — |
| SMILES | CC.CN.[B]C1=C([B])C([B])([B])C(c2sc3c(NCc4ccco4)nc(Cl)nc3c2C)CC1([B])[B] |
| InChI | InChI=1S/C18H12B6ClN3OS.C2H6.CH5N/c1-7-10-12(15(28-16(25)27-10)26-6-8-3-2-4-29-8)30-11(7)9-5-17(21,22)13(19)14(20)18(9,23)24;2*1-2/h2-4,9H,5-6H2,1H3,(H,26,27,28);1-2H3;2H2,1H3 |
| InChIKey | QTENCUSRQCYEHC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|