C21H19B6ClN2OS — CID 170644357
CID 170644357 (PubChem CID 170644357) has the molecular formula C21H19B6ClN2OS and a molecular weight of 447.79 g/mol.
| Compound Name | CID 170644357 |
|---|---|
| PubChem CID | 170644357 |
| Molecular Formula | C21H19B6ClN2OS |
| Molecular Weight | 447.79 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | — |
| SMILES | CC.[B]C1=C([B])C([B])([B])C(c2sc3c(NCc4ccco4)cc(Cl)nc3c2C)CC1([B])[B] |
| InChI | InChI=1S/C19H13B6ClN2OS.C2H6/c1-8-13-15(11(5-12(26)28-13)27-7-9-3-2-4-29-9)30-14(8)10-6-18(22,23)16(20)17(21)19(10,24)25;1-2/h2-5,10H,6-7H2,1H3,(H,27,28);1-2H3 |
| InChIKey | NEJZQJOJHMFTTN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.79 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|