C17H17BrClN3O2S — CID 170644716
2-[(2S,3S)-3-aminooxan-2-yl]-3-bromo-5-chloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170644716) has the molecular formula C17H17BrClN3O2S and a molecular weight of 442.77 g/mol. Its IUPAC name is 2-[(2S,3S)-3-aminooxan-2-yl]-3-bromo-5-chloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(2S,3S)-3-aminooxan-2-yl]-3-bromo-5-chloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644716 |
| Molecular Formula | C17H17BrClN3O2S |
| Molecular Weight | 442.77 g/mol |
| Exact Mass | 440.99 |
| IUPAC Name | 2-[(2S,3S)-3-aminooxan-2-yl]-3-bromo-5-chloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | N[C@H]1CCCO[C@@H]1c1sc2c(NCc3ccco3)cc(Cl)nc2c1Br |
| InChI | InChI=1S/C17H17BrClN3O2S/c18-13-14-16(25-17(13)15-10(20)4-2-6-24-15)11(7-12(19)22-14)21-8-9-3-1-5-23-9/h1,3,5,7,10,15H,2,4,6,8,20H2,(H,21,22)/t10-,15-/m0/s1 |
| InChIKey | JRRDZEASBPARIV-BONVTDFDSA-N |
| XLogP | 5.10 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.77 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|