C18H18BrClN4OS — CID 170644028
2-[(2S,3S)-3-aminooxan-2-yl]-3-bromo-5-chloro-N-(pyridin-4-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170644028) has the molecular formula C18H18BrClN4OS and a molecular weight of 453.79 g/mol. Its IUPAC name is 2-[(2S,3S)-3-aminooxan-2-yl]-3-bromo-5-chloro-N-(pyridin-4-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(2S,3S)-3-aminooxan-2-yl]-3-bromo-5-chloro-N-(pyridin-4-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644028 |
| Molecular Formula | C18H18BrClN4OS |
| Molecular Weight | 453.79 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | 2-[(2S,3S)-3-aminooxan-2-yl]-3-bromo-5-chloro-N-(pyridin-4-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | N[C@H]1CCCO[C@@H]1c1sc2c(NCc3ccncc3)cc(Cl)nc2c1Br |
| InChI | InChI=1S/C18H18BrClN4OS/c19-14-15-17(26-18(14)16-11(21)2-1-7-25-16)12(8-13(20)24-15)23-9-10-3-5-22-6-4-10/h3-6,8,11,16H,1-2,7,9,21H2,(H,23,24)/t11-,16-/m0/s1 |
| InChIKey | PADPNLOGCRBAAO-ZBEGNZNMSA-N |
| XLogP | 4.90 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.79 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|