C19H18BrClN2OS — CID 170644152
N-benzyl-3-bromo-5-chloro-2-[(2R)-oxan-2-yl]thieno[3,2-b]pyridin-7-amine (PubChem CID 170644152) has the molecular formula C19H18BrClN2OS and a molecular weight of 437.79 g/mol. Its IUPAC name is N-benzyl-3-bromo-5-chloro-2-[(2R)-oxan-2-yl]thieno[3,2-b]pyridin-7-amine.
| Compound Name | N-benzyl-3-bromo-5-chloro-2-[(2R)-oxan-2-yl]thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644152 |
| Molecular Formula | C19H18BrClN2OS |
| Molecular Weight | 437.79 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | N-benzyl-3-bromo-5-chloro-2-[(2R)-oxan-2-yl]thieno[3,2-b]pyridin-7-amine |
| SMILES | Clc1cc(NCc2ccccc2)c2sc([C@H]3CCCCO3)c(Br)c2n1 |
| InChI | InChI=1S/C19H18BrClN2OS/c20-16-17-18(25-19(16)14-8-4-5-9-24-14)13(10-15(21)23-17)22-11-12-6-2-1-3-7-12/h1-3,6-7,10,14H,4-5,8-9,11H2,(H,22,23)/t14-/m1/s1 |
| InChIKey | OFQAIJRRNWWNKZ-CQSZACIVSA-N |
| XLogP | 6.57 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.79 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|