C19H18ClFN2OS — CID 170644359
5-chloro-N-[(2-fluorophenyl)methyl]-2-[(2R)-oxan-2-yl]thieno[3,2-b]pyridin-7-amine (PubChem CID 170644359) has the molecular formula C19H18ClFN2OS and a molecular weight of 376.88 g/mol. Its IUPAC name is 5-chloro-N-[(2-fluorophenyl)methyl]-2-[(2R)-oxan-2-yl]thieno[3,2-b]pyridin-7-amine.
| Compound Name | 5-chloro-N-[(2-fluorophenyl)methyl]-2-[(2R)-oxan-2-yl]thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644359 |
| Molecular Formula | C19H18ClFN2OS |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 5-chloro-N-[(2-fluorophenyl)methyl]-2-[(2R)-oxan-2-yl]thieno[3,2-b]pyridin-7-amine |
| SMILES | Fc1ccccc1CNc1cc(Cl)nc2cc([C@H]3CCCCO3)sc12 |
| InChI | InChI=1S/C19H18ClFN2OS/c20-18-10-14(22-11-12-5-1-2-6-13(12)21)19-15(23-18)9-17(25-19)16-7-3-4-8-24-16/h1-2,5-6,9-10,16H,3-4,7-8,11H2,(H,22,23)/t16-/m1/s1 |
| InChIKey | XMQRGKALOSIKAP-MRXNPFEDSA-N |
| XLogP | 5.94 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|