C20H17F3N2OS — CID 99636640
N-[[2-[(2R)-oxolan-2-yl]-1,3-thiazol-4-yl]methyl]-2-(3,4,5-trifluorophenyl)aniline (PubChem CID 99636640) has the molecular formula C20H17F3N2OS and a molecular weight of 390.43 g/mol. Its IUPAC name is N-[[2-[(2R)-oxolan-2-yl]-1,3-thiazol-4-yl]methyl]-2-(3,4,5-trifluorophenyl)aniline.
| Compound Name | N-[[2-[(2R)-oxolan-2-yl]-1,3-thiazol-4-yl]methyl]-2-(3,4,5-trifluorophenyl)aniline |
|---|---|
| PubChem CID | 99636640 |
| Molecular Formula | C20H17F3N2OS |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N-[[2-[(2R)-oxolan-2-yl]-1,3-thiazol-4-yl]methyl]-2-(3,4,5-trifluorophenyl)aniline |
| SMILES | Fc1cc(-c2ccccc2NCc2csc([C@H]3CCCO3)n2)cc(F)c1F |
| InChI | InChI=1S/C20H17F3N2OS/c21-15-8-12(9-16(22)19(15)23)14-4-1-2-5-17(14)24-10-13-11-27-20(25-13)18-6-3-7-26-18/h1-2,4-5,8-9,11,18,24H,3,6-7,10H2/t18-/m1/s1 |
| InChIKey | MFCKOFVNBQMQDE-GOSISDBHSA-N |
| XLogP | 5.69 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|