C11H18N2OS — CID 65328319
N-[[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methyl]propan-1-amine (PubChem CID 65328319) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is N-[[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 65328319 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-[[2-(oxolan-2-yl)-1,3-thiazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1csc(C2CCCO2)n1 |
| InChI | InChI=1S/C11H18N2OS/c1-2-5-12-7-9-8-15-11(13-9)10-4-3-6-14-10/h8,10,12H,2-7H2,1H3 |
| InChIKey | HQXKIUZSCOMYPN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|