C16H19BrN2O3S — CID 99701326
5-bromo-2,4-dimethoxy-N-[[2-[(2S)-oxolan-2-yl]-1,3-thiazol-4-yl]methyl]aniline (PubChem CID 99701326) has the molecular formula C16H19BrN2O3S and a molecular weight of 399.31 g/mol. Its IUPAC name is 5-bromo-2,4-dimethoxy-N-[[2-[(2S)-oxolan-2-yl]-1,3-thiazol-4-yl]methyl]aniline.
| Compound Name | 5-bromo-2,4-dimethoxy-N-[[2-[(2S)-oxolan-2-yl]-1,3-thiazol-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 99701326 |
| Molecular Formula | C16H19BrN2O3S |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 5-bromo-2,4-dimethoxy-N-[[2-[(2S)-oxolan-2-yl]-1,3-thiazol-4-yl]methyl]aniline |
| SMILES | COc1cc(OC)c(NCc2csc([C@@H]3CCCO3)n2)cc1Br |
| InChI | InChI=1S/C16H19BrN2O3S/c1-20-14-7-15(21-2)12(6-11(14)17)18-8-10-9-23-16(19-10)13-4-3-5-22-13/h6-7,9,13,18H,3-5,8H2,1-2H3/t13-/m0/s1 |
| InChIKey | RUJBYSNWIFNZDZ-ZDUSSCGKSA-N |
| XLogP | 4.39 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|