C13H15BrN2O2S — CID 86817191
5-bromo-2,4-dimethoxy-N-[(4-methyl-1,3-thiazol-5-yl)methyl]aniline (PubChem CID 86817191) has the molecular formula C13H15BrN2O2S and a molecular weight of 343.25 g/mol. Its IUPAC name is 5-bromo-2,4-dimethoxy-N-[(4-methyl-1,3-thiazol-5-yl)methyl]aniline.
| Compound Name | 5-bromo-2,4-dimethoxy-N-[(4-methyl-1,3-thiazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 86817191 |
| Molecular Formula | C13H15BrN2O2S |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 5-bromo-2,4-dimethoxy-N-[(4-methyl-1,3-thiazol-5-yl)methyl]aniline |
| SMILES | COc1cc(OC)c(NCc2scnc2C)cc1Br |
| InChI | InChI=1S/C13H15BrN2O2S/c1-8-13(19-7-16-8)6-15-10-4-9(14)11(17-2)5-12(10)18-3/h4-5,7,15H,6H2,1-3H3 |
| InChIKey | LGNJNEOYPZHSGV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|