C16H10ClFN2S — CID 170644962
5-chloro-3-ethynyl-N-[(2-fluorophenyl)methyl]thieno[3,2-b]pyridin-7-amine (PubChem CID 170644962) has the molecular formula C16H10ClFN2S and a molecular weight of 316.79 g/mol. Its IUPAC name is 5-chloro-3-ethynyl-N-[(2-fluorophenyl)methyl]thieno[3,2-b]pyridin-7-amine.
| Compound Name | 5-chloro-3-ethynyl-N-[(2-fluorophenyl)methyl]thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644962 |
| Molecular Formula | C16H10ClFN2S |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 5-chloro-3-ethynyl-N-[(2-fluorophenyl)methyl]thieno[3,2-b]pyridin-7-amine |
| SMILES | C#Cc1csc2c(NCc3ccccc3F)cc(Cl)nc12 |
| InChI | InChI=1S/C16H10ClFN2S/c1-2-10-9-21-16-13(7-14(17)20-15(10)16)19-8-11-5-3-4-6-12(11)18/h1,3-7,9H,8H2,(H,19,20) |
| InChIKey | KDAVQBFDUSPLDT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|