About 3,5-dichloro-N-[(3-fluoro-4-pyridinyl)methyl]thieno[3,2-b]pyridin-7-amine
3,5-dichloro-N-[(3-fluoro-4-pyridinyl)methyl]thieno[3,2-b]pyridin-7-amine (PubChem CID 170644333) has the molecular formula C13H8Cl2FN3S
and a molecular weight of 328.20 g/mol. Its IUPAC name is 3,5-dichloro-N-[(3-fluoro-4-pyridinyl)methyl]thieno[3,2-b]pyridin-7-amine.
Molecular Properties
| Compound Name | 3,5-dichloro-N-[(3-fluoro-4-pyridinyl)methyl]thieno[3,2-b]pyridin-7-amine |
| PubChem CID | 170644333 |
| Molecular Formula | C13H8Cl2FN3S |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 3,5-dichloro-N-[(3-fluoro-4-pyridinyl)methyl]thieno[3,2-b]pyridin-7-amine |
| SMILES | Fc1cnccc1CNc1cc(Cl)nc2c(Cl)csc12 |
| InChI | InChI=1S/C13H8Cl2FN3S/c14-8-6-20-13-10(3-11(15)19-12(8)13)18-4-7-1-2-17-5-9(7)16/h1-3,5-6H,4H2,(H,18,19) |
| InChIKey | OOXXKKAYALYBAQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-N-[(3-fluoro-4-pyridinyl)methyl]thieno[3,2-b]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-N-[(3-fluoro-4-pyridinyl)methyl]thieno[3,2-b]pyridin-7-amine?
The IUPAC name of 3,5-dichloro-N-[(3-fluoro-4-pyridinyl)methyl]thieno[3,2-b]pyridin-7-amine (CID 170644333) is 3,5-dichloro-N-[(3-fluoro-4-pyridinyl)methyl]thieno[3,2-b]pyridin-7-amine.
What is the SMILES notation for 3,5-dichloro-N-[(3-fluoro-4-pyridinyl)methyl]thieno[3,2-b]pyridin-7-amine?
The canonical SMILES for 3,5-dichloro-N-[(3-fluoro-4-pyridinyl)methyl]thieno[3,2-b]pyridin-7-amine is Fc1cnccc1CNc1cc(Cl)nc2c(Cl)csc12.
What is the InChIKey of 3,5-dichloro-N-[(3-fluoro-4-pyridinyl)methyl]thieno[3,2-b]pyridin-7-amine?
The InChIKey is OOXXKKAYALYBAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2FN3S/c14-8-6-20-13-10(3-11(15)19-12(8)13)18-4-7-1-2-17-5-9(7)16/h1-3,5-6H,4H2,(H,18,19).
What are the key properties of 3,5-dichloro-N-[(3-fluoro-4-pyridinyl)methyl]thieno[3,2-b]pyridin-7-amine?
3,5-dichloro-N-[(3-fluoro-4-pyridinyl)methyl]thieno[3,2-b]pyridin-7-amine has a molecular weight of 328.20 g/mol, XLogP of 4.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-N-[(3-fluoro-4-pyridinyl)methyl]thieno[3,2-b]pyridin-7-amine is sourced from PubChem (CID 170644333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).