C17H18ClFN4S — CID 175365847
2-(2-aminopropyl)-5-chloro-N-[(3-fluoro-4-pyridinyl)methyl]-3-methylthieno[3,2-b]pyridin-7-amine (PubChem CID 175365847) has the molecular formula C17H18ClFN4S and a molecular weight of 364.88 g/mol. Its IUPAC name is 2-(2-aminopropyl)-5-chloro-N-[(3-fluoro-4-pyridinyl)methyl]-3-methylthieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-(2-aminopropyl)-5-chloro-N-[(3-fluoro-4-pyridinyl)methyl]-3-methylthieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 175365847 |
| Molecular Formula | C17H18ClFN4S |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 2-(2-aminopropyl)-5-chloro-N-[(3-fluoro-4-pyridinyl)methyl]-3-methylthieno[3,2-b]pyridin-7-amine |
| SMILES | Cc1c(CC(C)N)sc2c(NCc3ccncc3F)cc(Cl)nc12 |
| InChI | InChI=1S/C17H18ClFN4S/c1-9(20)5-14-10(2)16-17(24-14)13(6-15(18)23-16)22-7-11-3-4-21-8-12(11)19/h3-4,6,8-9H,5,7,20H2,1-2H3,(H,22,23) |
| InChIKey | FZFKSRREPQEGAM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|