C17H20ClN3S2 — CID 162390977
2-[(2S)-2-aminobutyl]-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 162390977) has the molecular formula C17H20ClN3S2 and a molecular weight of 365.96 g/mol. Its IUPAC name is 2-[(2S)-2-aminobutyl]-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(2S)-2-aminobutyl]-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 162390977 |
| Molecular Formula | C17H20ClN3S2 |
| Molecular Weight | 365.96 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 2-[(2S)-2-aminobutyl]-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | CC[C@H](N)Cc1sc2c(NCc3cccs3)cc(Cl)nc2c1C |
| InChI | InChI=1S/C17H20ClN3S2/c1-3-11(19)7-14-10(2)16-17(23-14)13(8-15(18)21-16)20-9-12-5-4-6-22-12/h4-6,8,11H,3,7,9,19H2,1-2H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | FLQCAFCNKQQYEZ-NSHDSACASA-N |
| XLogP | 5.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.96 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|