C20H24ClN3S2 — CID 170643902
2-[(1R,2S)-2-aminocycloheptyl]-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170643902) has the molecular formula C20H24ClN3S2 and a molecular weight of 406.02 g/mol. Its IUPAC name is 2-[(1R,2S)-2-aminocycloheptyl]-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(1R,2S)-2-aminocycloheptyl]-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170643902 |
| Molecular Formula | C20H24ClN3S2 |
| Molecular Weight | 406.02 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-[(1R,2S)-2-aminocycloheptyl]-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | Cc1c([C@@H]2CCCCC[C@@H]2N)sc2c(NCc3cccs3)cc(Cl)nc12 |
| InChI | InChI=1S/C20H24ClN3S2/c1-12-18-20(26-19(12)14-7-3-2-4-8-15(14)22)16(10-17(21)24-18)23-11-13-6-5-9-25-13/h5-6,9-10,14-15H,2-4,7-8,11,22H2,1H3,(H,23,24)/t14-,15+/m1/s1 |
| InChIKey | ICCHGDBAEVUMMI-CABCVRRESA-N |
| XLogP | 6.31 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.02 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|