C22H24ClN3O2S2 — CID 175972039
2-[(1R,2R)-2-aminocyclohexyl]-5-chloro-3-prop-1-ynyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;formic acid (PubChem CID 175972039) has the molecular formula C22H24ClN3O2S2 and a molecular weight of 462.04 g/mol. Its IUPAC name is 2-[(1R,2R)-2-aminocyclohexyl]-5-chloro-3-prop-1-ynyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;formic acid.
| Compound Name | 2-[(1R,2R)-2-aminocyclohexyl]-5-chloro-3-prop-1-ynyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;formic acid |
|---|---|
| PubChem CID | 175972039 |
| Molecular Formula | C22H24ClN3O2S2 |
| Molecular Weight | 462.04 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 2-[(1R,2R)-2-aminocyclohexyl]-5-chloro-3-prop-1-ynyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;formic acid |
| SMILES | CC#Cc1c([C@@H]2CCCC[C@H]2N)sc2c(NCc3cccs3)cc(Cl)nc12.O=CO |
| InChI | InChI=1S/C21H22ClN3S2.CH2O2/c1-2-6-15-19-21(27-20(15)14-8-3-4-9-16(14)23)17(11-18(22)25-19)24-12-13-7-5-10-26-13;2-1-3/h5,7,10-11,14,16H,3-4,8-9,12,23H2,1H3,(H,24,25);1H,(H,2,3)/t14-,16-;/m1./s1 |
| InChIKey | UAMWTXMEXOFONO-VNYZMKMESA-N |
| XLogP | 5.68 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.04 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|