C20H22ClN3O3S2 — CID 175971942
2-[(3R,4S)-3-aminooxan-4-yl]-5-chloro-3-ethenyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;formic acid (PubChem CID 175971942) has the molecular formula C20H22ClN3O3S2 and a molecular weight of 452.00 g/mol. Its IUPAC name is 2-[(3R,4S)-3-aminooxan-4-yl]-5-chloro-3-ethenyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;formic acid.
| Compound Name | 2-[(3R,4S)-3-aminooxan-4-yl]-5-chloro-3-ethenyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;formic acid |
|---|---|
| PubChem CID | 175971942 |
| Molecular Formula | C20H22ClN3O3S2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 2-[(3R,4S)-3-aminooxan-4-yl]-5-chloro-3-ethenyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;formic acid |
| SMILES | C=Cc1c([C@H]2CCOC[C@@H]2N)sc2c(NCc3cccs3)cc(Cl)nc12.O=CO |
| InChI | InChI=1S/C19H20ClN3OS2.CH2O2/c1-2-12-17-19(26-18(12)13-5-6-24-10-14(13)21)15(8-16(20)23-17)22-9-11-4-3-7-25-11;2-1-3/h2-4,7-8,13-14H,1,5-6,9-10,21H2,(H,22,23);1H,(H,2,3)/t13-,14-;/m0./s1 |
| InChIKey | NKQWAGXELJWZJZ-IODNYQNNSA-N |
| XLogP | 4.80 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|