C19H22ClN3S2 — CID 170643905
2-[(1R,2R)-2-aminocyclohexyl]-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170643905) has the molecular formula C19H22ClN3S2 and a molecular weight of 391.99 g/mol. Its IUPAC name is 2-[(1R,2R)-2-aminocyclohexyl]-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(1R,2R)-2-aminocyclohexyl]-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170643905 |
| Molecular Formula | C19H22ClN3S2 |
| Molecular Weight | 391.99 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-[(1R,2R)-2-aminocyclohexyl]-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | Cc1c([C@@H]2CCCC[C@H]2N)sc2c(NCc3cccs3)cc(Cl)nc12 |
| InChI | InChI=1S/C19H22ClN3S2/c1-11-17-19(25-18(11)13-6-2-3-7-14(13)21)15(9-16(20)23-17)22-10-12-5-4-8-24-12/h4-5,8-9,13-14H,2-3,6-7,10,21H2,1H3,(H,22,23)/t13-,14-/m1/s1 |
| InChIKey | QXXOHXVFJMURIU-ZIAGYGMSSA-N |
| XLogP | 5.92 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.99 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|