C14H14ClN3S2 — CID 155066343
2-(aminomethyl)-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 155066343) has the molecular formula C14H14ClN3S2 and a molecular weight of 323.87 g/mol. Its IUPAC name is 2-(aminomethyl)-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-(aminomethyl)-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 155066343 |
| Molecular Formula | C14H14ClN3S2 |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-(aminomethyl)-5-chloro-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | Cc1c(CN)sc2c(NCc3cccs3)cc(Cl)nc12 |
| InChI | InChI=1S/C14H14ClN3S2/c1-8-11(6-16)20-14-10(5-12(15)18-13(8)14)17-7-9-3-2-4-19-9/h2-5H,6-7,16H2,1H3,(H,17,18) |
| InChIKey | MHRIXUZMJBBJOV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|