C17H20N4S2 — CID 170792205
2-(2-aminoethyl)-5-(aziridin-2-yl)-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170792205) has the molecular formula C17H20N4S2 and a molecular weight of 344.51 g/mol. Its IUPAC name is 2-(2-aminoethyl)-5-(aziridin-2-yl)-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-(2-aminoethyl)-5-(aziridin-2-yl)-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170792205 |
| Molecular Formula | C17H20N4S2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-(2-aminoethyl)-5-(aziridin-2-yl)-3-methyl-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | Cc1c(CCN)sc2c(NCc3cccs3)cc(C3CN3)nc12 |
| InChI | InChI=1S/C17H20N4S2/c1-10-15(4-5-18)23-17-13(19-8-11-3-2-6-22-11)7-12(14-9-20-14)21-16(10)17/h2-3,6-7,14,20H,4-5,8-9,18H2,1H3,(H,19,21) |
| InChIKey | MKRMHSPXFKVECJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|