C16H19BrCl3N3S2 — CID 162390867
2-[(2S)-2-aminobutyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;dihydrochloride (PubChem CID 162390867) has the molecular formula C16H19BrCl3N3S2 and a molecular weight of 503.75 g/mol. Its IUPAC name is 2-[(2S)-2-aminobutyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;dihydrochloride.
| Compound Name | 2-[(2S)-2-aminobutyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;dihydrochloride |
|---|---|
| PubChem CID | 162390867 |
| Molecular Formula | C16H19BrCl3N3S2 |
| Molecular Weight | 503.75 g/mol |
| Exact Mass | 500.93 |
| IUPAC Name | 2-[(2S)-2-aminobutyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;dihydrochloride |
| SMILES | CC[C@H](N)Cc1sc2c(NCc3cccs3)cc(Cl)nc2c1Br.Cl.Cl |
| InChI | InChI=1S/C16H17BrClN3S2.2ClH/c1-2-9(19)6-12-14(17)15-16(23-12)11(7-13(18)21-15)20-8-10-4-3-5-22-10;;/h3-5,7,9H,2,6,8,19H2,1H3,(H,20,21);2*1H/t9-;;/m0../s1 |
| InChIKey | WHCJLLTXCZVINQ-WWPIYYJJSA-N |
| XLogP | 6.51 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.75 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|