C15H17BrCl3N3O2S — CID 162390821
(2R)-2-amino-3-[3-bromo-5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]propan-1-ol;dihydrochloride (PubChem CID 162390821) has the molecular formula C15H17BrCl3N3O2S and a molecular weight of 489.65 g/mol. Its IUPAC name is (2R)-2-amino-3-[3-bromo-5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]propan-1-ol;dihydrochloride.
| Compound Name | (2R)-2-amino-3-[3-bromo-5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]propan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 162390821 |
| Molecular Formula | C15H17BrCl3N3O2S |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 486.93 |
| IUPAC Name | (2R)-2-amino-3-[3-bromo-5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]propan-1-ol;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H](CO)Cc1sc2c(NCc3ccco3)cc(Cl)nc2c1Br |
| InChI | InChI=1S/C15H15BrClN3O2S.2ClH/c16-13-11(4-8(18)7-21)23-15-10(5-12(17)20-14(13)15)19-6-9-2-1-3-22-9;;/h1-3,5,8,21H,4,6-7,18H2,(H,19,20);2*1H/t8-;;/m1../s1 |
| InChIKey | ADLXOHUIUUDIRS-YCBDHFTFSA-N |
| XLogP | 4.62 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|