C17H19ClFN3OS — CID 162390990
2-[(2S)-2-amino-4-fluorobutyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine (PubChem CID 162390990) has the molecular formula C17H19ClFN3OS and a molecular weight of 367.88 g/mol. Its IUPAC name is 2-[(2S)-2-amino-4-fluorobutyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(2S)-2-amino-4-fluorobutyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 162390990 |
| Molecular Formula | C17H19ClFN3OS |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-[(2S)-2-amino-4-fluorobutyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine |
| SMILES | Cc1c(C[C@@H](N)CCF)sc2c(NCc3ccco3)cc(Cl)nc12 |
| InChI | InChI=1S/C17H19ClFN3OS/c1-10-14(7-11(20)4-5-19)24-17-13(8-15(18)22-16(10)17)21-9-12-3-2-6-23-12/h2-3,6,8,11H,4-5,7,9,20H2,1H3,(H,21,22)/t11-/m0/s1 |
| InChIKey | JAUNNCANADLKTG-NSHDSACASA-N |
| XLogP | 4.69 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|