C17H18Cl3N3OS — CID 162391107
2-[(2R)-2-aminobut-3-ynyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine;dihydrochloride (PubChem CID 162391107) has the molecular formula C17H18Cl3N3OS and a molecular weight of 418.78 g/mol. Its IUPAC name is 2-[(2R)-2-aminobut-3-ynyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine;dihydrochloride.
| Compound Name | 2-[(2R)-2-aminobut-3-ynyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine;dihydrochloride |
|---|---|
| PubChem CID | 162391107 |
| Molecular Formula | C17H18Cl3N3OS |
| Molecular Weight | 418.78 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 2-[(2R)-2-aminobut-3-ynyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine;dihydrochloride |
| SMILES | C#C[C@H](N)Cc1sc2c(NCc3ccco3)cc(Cl)nc2c1C.Cl.Cl |
| InChI | InChI=1S/C17H16ClN3OS.2ClH/c1-3-11(19)7-14-10(2)16-17(23-14)13(8-15(18)21-16)20-9-12-5-4-6-22-12;;/h1,4-6,8,11H,7,9,19H2,2H3,(H,20,21);2*1H/t11-;;/m0../s1 |
| InChIKey | HTZMNDRJTKFEGL-IDMXKUIJSA-N |
| XLogP | 4.81 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.78 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|