C21H28ClN3O2S2 — CID 175723577
tert-butyl-[[(2S,3R)-3-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]butan-2-yl]amino]-oxidosulfanium (PubChem CID 175723577) has the molecular formula C21H28ClN3O2S2 and a molecular weight of 454.06 g/mol. Its IUPAC name is tert-butyl-[[(2S,3R)-3-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]butan-2-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(2S,3R)-3-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]butan-2-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175723577 |
| Molecular Formula | C21H28ClN3O2S2 |
| Molecular Weight | 454.06 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | tert-butyl-[[(2S,3R)-3-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]butan-2-yl]amino]-oxidosulfanium |
| SMILES | Cc1c([C@H](C)[C@H](C)N[S+]([O-])C(C)(C)C)sc2c(NCc3ccco3)cc(Cl)nc12 |
| InChI | InChI=1S/C21H28ClN3O2S2/c1-12(14(3)25-29(26)21(4,5)6)19-13(2)18-20(28-19)16(10-17(22)24-18)23-11-15-8-7-9-27-15/h7-10,12,14,25H,11H2,1-6H3,(H,23,24)/t12-,14+,29?/m1/s1 |
| InChIKey | VENRCPVZKHGTSR-HCZCFSJOSA-N |
| XLogP | 6.01 |
| TPSA | 73.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.06 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|