C20H21Cl2N3OS — CID 170644875
2-[(1S,2R,5S,6S)-6-amino-2,5-dimethylcyclohex-3-en-1-yl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170644875) has the molecular formula C20H21Cl2N3OS and a molecular weight of 422.38 g/mol. Its IUPAC name is 2-[(1S,2R,5S,6S)-6-amino-2,5-dimethylcyclohex-3-en-1-yl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(1S,2R,5S,6S)-6-amino-2,5-dimethylcyclohex-3-en-1-yl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644875 |
| Molecular Formula | C20H21Cl2N3OS |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 2-[(1S,2R,5S,6S)-6-amino-2,5-dimethylcyclohex-3-en-1-yl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | C[C@@H]1C=C[C@H](C)[C@H](N)[C@H]1c1sc2c(NCc3ccco3)cc(Cl)nc2c1Cl |
| InChI | InChI=1S/C20H21Cl2N3OS/c1-10-5-6-11(2)17(23)15(10)20-16(22)18-19(27-20)13(8-14(21)25-18)24-9-12-4-3-7-26-12/h3-8,10-11,15,17H,9,23H2,1-2H3,(H,24,25)/t10-,11+,15+,17+/m1/s1 |
| InChIKey | FTNVGELMSMQNLF-XSAQDOAFSA-N |
| XLogP | 6.06 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|