C20H18Cl2F3N3O3S — CID 175972069
2-[(1R,6R)-6-amino-2,2,3,4,5,5-hexadeuteriocyclohex-3-en-1-yl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid (PubChem CID 175972069) has the molecular formula C20H18Cl2F3N3O3S and a molecular weight of 514.39 g/mol. Its IUPAC name is 2-[(1R,6R)-6-amino-2,2,3,4,5,5-hexadeuteriocyclohex-3-en-1-yl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(1R,6R)-6-amino-2,2,3,4,5,5-hexadeuteriocyclohex-3-en-1-yl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175972069 |
| Molecular Formula | C20H18Cl2F3N3O3S |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | 2-[(1R,6R)-6-amino-2,2,3,4,5,5-hexadeuteriocyclohex-3-en-1-yl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[2H]C1=C([2H])C([2H])([2H])[C@@H](c2sc3c(NCc4ccco4)cc(Cl)nc3c2Cl)[C@H](N)C1([2H])[2H] |
| InChI | InChI=1S/C18H17Cl2N3OS.C2HF3O2/c19-14-8-13(22-9-10-4-3-7-24-10)18-16(23-14)15(20)17(25-18)11-5-1-2-6-12(11)21;3-2(4,5)1(6)7/h1-4,7-8,11-12H,5-6,9,21H2,(H,22,23);(H,6,7)/t11-,12-;/m1./s1/i1D,2D,5D2,6D2; |
| InChIKey | ICOLMJGHSJYHJP-QJKSEAIRSA-N |
| XLogP | 6.20 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|