C21H20BrClF3N3O2S2 — CID 175972057
2-[(1S,3S,4S,6R)-4-amino-3-bicyclo[4.1.0]heptanyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid (PubChem CID 175972057) has the molecular formula C21H20BrClF3N3O2S2 and a molecular weight of 582.90 g/mol. Its IUPAC name is 2-[(1S,3S,4S,6R)-4-amino-3-bicyclo[4.1.0]heptanyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(1S,3S,4S,6R)-4-amino-3-bicyclo[4.1.0]heptanyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175972057 |
| Molecular Formula | C21H20BrClF3N3O2S2 |
| Molecular Weight | 582.90 g/mol |
| Exact Mass | 580.98 |
| IUPAC Name | 2-[(1S,3S,4S,6R)-4-amino-3-bicyclo[4.1.0]heptanyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)thieno[3,2-b]pyridin-7-amine;2,2,2-trifluoroacetic acid |
| SMILES | N[C@H]1C[C@H]2C[C@H]2C[C@@H]1c1sc2c(NCc3cccs3)cc(Cl)nc2c1Br.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H19BrClN3S2.C2HF3O2/c20-16-17-19(26-18(16)12-5-9-4-10(9)6-13(12)22)14(7-15(21)24-17)23-8-11-2-1-3-25-11;3-2(4,5)1(6)7/h1-3,7,9-10,12-13H,4-6,8,22H2,(H,23,24);(H,6,7)/t9-,10+,12-,13-;/m0./s1 |
| InChIKey | WUQLYWCURWBSNH-OIXSAMFISA-N |
| XLogP | 6.86 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.90 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|