C20H18BrClF3N3O2S2 — CID 176900251
[(1R,2R,3S)-2-amino-3-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]cyclohexyl] 2,2,2-trifluoroacetate (PubChem CID 176900251) has the molecular formula C20H18BrClF3N3O2S2 and a molecular weight of 568.87 g/mol. Its IUPAC name is [(1R,2R,3S)-2-amino-3-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]cyclohexyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1R,2R,3S)-2-amino-3-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]cyclohexyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 176900251 |
| Molecular Formula | C20H18BrClF3N3O2S2 |
| Molecular Weight | 568.87 g/mol |
| Exact Mass | 566.97 |
| IUPAC Name | [(1R,2R,3S)-2-amino-3-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]cyclohexyl] 2,2,2-trifluoroacetate |
| SMILES | N[C@@H]1[C@@H](c2sc3c(NCc4cccs4)cc(Cl)nc3c2Br)CCC[C@H]1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H18BrClF3N3O2S2/c21-14-16-18(11(7-13(22)28-16)27-8-9-3-2-6-31-9)32-17(14)10-4-1-5-12(15(10)26)30-19(29)20(23,24)25/h2-3,6-7,10,12,15H,1,4-5,8,26H2,(H,27,28)/t10-,12+,15+/m0/s1 |
| InChIKey | IDBPGPILHICUCD-JVLSTEMRSA-N |
| XLogP | 6.45 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.87 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|